C13H22 — CID 140892092
1,3,5,7-tetramethyltricyclo[3.3.1.03,7]nonane (PubChem CID 140892092) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is 1,3,5,7-tetramethyltricyclo[3.3.1.03,7]nonane.
| Compound Name | 1,3,5,7-tetramethyltricyclo[3.3.1.03,7]nonane |
|---|---|
| PubChem CID | 140892092 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 1,3,5,7-tetramethyltricyclo[3.3.1.03,7]nonane |
| SMILES | CC12CC3(C)CC(C)(C1)C(C)(C2)C3 |
| InChI | InChI=1S/C13H22/c1-10-5-11(2)8-12(3,6-10)13(4,7-10)9-11/h5-9H2,1-4H3 |
| InChIKey | CSZCHGMFQLGIEP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |