C13H25NO — CID 142767808
azanium 3,5,7-trimethyladamantan-1-olate (PubChem CID 142767808) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is azanium 3,5,7-trimethyladamantan-1-olate.
| Compound Name | azanium 3,5,7-trimethyladamantan-1-olate |
|---|---|
| PubChem CID | 142767808 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | azanium 3,5,7-trimethyladamantan-1-olate |
| SMILES | CC12CC3(C)CC(C)(C1)CC([O-])(C2)C3.[NH4+] |
| InChI | InChI=1S/C13H21O.H3N/c1-10-4-11(2)6-12(3,5-10)9-13(14,7-10)8-11;/h4-9H2,1-3H3;1H3/q-1;/p+1 |
| InChIKey | HRCTZUWMSZRLMF-UHFFFAOYSA-O |
| XLogP | 2.86 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |