C16H26O — CID 59904260
2-methyl-3-(3,5,7-trimethyl-1-adamantyl)oxirane (PubChem CID 59904260) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 2-methyl-3-(3,5,7-trimethyl-1-adamantyl)oxirane.
| Compound Name | 2-methyl-3-(3,5,7-trimethyl-1-adamantyl)oxirane |
|---|---|
| PubChem CID | 59904260 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 2-methyl-3-(3,5,7-trimethyl-1-adamantyl)oxirane |
| SMILES | CC1OC1C12CC3(C)CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C16H26O/c1-11-12(17-11)16-8-13(2)5-14(3,9-16)7-15(4,6-13)10-16/h11-12H,5-10H2,1-4H3 |
| InChIKey | ALJGPQZUFVAIRH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|