About [3,5-dimethyl-7-(trimethylazaniumyl)-1-adamantyl]-trimethylazanium
[3,5-dimethyl-7-(trimethylazaniumyl)-1-adamantyl]-trimethylazanium (PubChem CID 139145155) has the molecular formula C18H36N2+2
and a molecular weight of 280.50 g/mol. Its IUPAC name is [3,5-dimethyl-7-(trimethylazaniumyl)-1-adamantyl]-trimethylazanium.
Molecular Properties
| Compound Name | [3,5-dimethyl-7-(trimethylazaniumyl)-1-adamantyl]-trimethylazanium |
| PubChem CID | 139145155 |
| Molecular Formula | C18H36N2+2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | [3,5-dimethyl-7-(trimethylazaniumyl)-1-adamantyl]-trimethylazanium |
| SMILES | CC12CC3(C)CC([N+](C)(C)C)(C1)CC([N+](C)(C)C)(C2)C3 |
| InChI | InChI=1S/C18H36N2/c1-15-9-16(2)12-17(10-15,19(3,4)5)14-18(11-15,13-16)20(6,7)8/h9-14H2,1-8H3/q+2 |
| InChIKey | YWZNZHSPJKGSJH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [3,5-dimethyl-7-(trimethylazaniumyl)-1-adamantyl]-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-dimethyl-7-(trimethylazaniumyl)-1-adamantyl]-trimethylazanium?
The IUPAC name of [3,5-dimethyl-7-(trimethylazaniumyl)-1-adamantyl]-trimethylazanium (CID 139145155) is [3,5-dimethyl-7-(trimethylazaniumyl)-1-adamantyl]-trimethylazanium.
What is the SMILES notation for [3,5-dimethyl-7-(trimethylazaniumyl)-1-adamantyl]-trimethylazanium?
The canonical SMILES for [3,5-dimethyl-7-(trimethylazaniumyl)-1-adamantyl]-trimethylazanium is CC12CC3(C)CC([N+](C)(C)C)(C1)CC([N+](C)(C)C)(C2)C3.
What is the InChIKey of [3,5-dimethyl-7-(trimethylazaniumyl)-1-adamantyl]-trimethylazanium?
The InChIKey is YWZNZHSPJKGSJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36N2/c1-15-9-16(2)12-17(10-15,19(3,4)5)14-18(11-15,13-16)20(6,7)8/h9-14H2,1-8H3/q+2.
What are the key properties of [3,5-dimethyl-7-(trimethylazaniumyl)-1-adamantyl]-trimethylazanium?
[3,5-dimethyl-7-(trimethylazaniumyl)-1-adamantyl]-trimethylazanium has a molecular weight of 280.50 g/mol, XLogP of 3.27, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-dimethyl-7-(trimethylazaniumyl)-1-adamantyl]-trimethylazanium is sourced from PubChem (CID 139145155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).