C19H32O — CID 20721983
2,2-dimethyl-1-(3,5,7-trimethyl-1-adamantyl)butan-1-one (PubChem CID 20721983) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is 2,2-dimethyl-1-(3,5,7-trimethyl-1-adamantyl)butan-1-one.
| Compound Name | 2,2-dimethyl-1-(3,5,7-trimethyl-1-adamantyl)butan-1-one |
|---|---|
| PubChem CID | 20721983 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | 2,2-dimethyl-1-(3,5,7-trimethyl-1-adamantyl)butan-1-one |
| SMILES | CCC(C)(C)C(=O)C12CC3(C)CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C19H32O/c1-7-15(2,3)14(20)19-11-16(4)8-17(5,12-19)10-18(6,9-16)13-19/h7-13H2,1-6H3 |
| InChIKey | ORQZQACWZKDYCJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |