C31H48 — CID 159055712
1,3-bis(ethenyl)-5,7-dimethyladamantane;1-ethenyl-3,5,7-trimethyladamantane (PubChem CID 159055712) has the molecular formula C31H48 and a molecular weight of 420.73 g/mol. Its IUPAC name is 1,3-bis(ethenyl)-5,7-dimethyladamantane;1-ethenyl-3,5,7-trimethyladamantane.
| Compound Name | 1,3-bis(ethenyl)-5,7-dimethyladamantane;1-ethenyl-3,5,7-trimethyladamantane |
|---|---|
| PubChem CID | 159055712 |
| Molecular Formula | C31H48 |
| Molecular Weight | 420.73 g/mol |
| Exact Mass | 420.38 |
| IUPAC Name | 1,3-bis(ethenyl)-5,7-dimethyladamantane;1-ethenyl-3,5,7-trimethyladamantane |
| SMILES | C=CC12CC3(C)CC(C)(C1)CC(C=C)(C3)C2.C=CC12CC3(C)CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C16H24.C15H24/c1-5-15-8-13(3)7-14(4,9-15)11-16(6-2,10-13)12-15;1-5-15-9-12(2)6-13(3,10-15)8-14(4,7-12)11-15/h5-6H,1-2,7-12H2,3-4H3;5H,1,6-11H2,2-4H3 |
| InChIKey | JXVIDHWWRGSLSG-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.73 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|