C17H23F3O3 — CID 144996499
(2Z,4E)-5-[1,5-dihydroxy-2,7,7-trimethyl-3-(trifluoromethyl)cyclohept-2-en-1-yl]-3-methylpenta-2,4-dienal (PubChem CID 144996499) has the molecular formula C17H23F3O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is (2Z,4E)-5-[1,5-dihydroxy-2,7,7-trimethyl-3-(trifluoromethyl)cyclohept-2-en-1-yl]-3-methylpenta-2,4-dienal.
| Compound Name | (2Z,4E)-5-[1,5-dihydroxy-2,7,7-trimethyl-3-(trifluoromethyl)cyclohept-2-en-1-yl]-3-methylpenta-2,4-dienal |
|---|---|
| PubChem CID | 144996499 |
| Molecular Formula | C17H23F3O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (2Z,4E)-5-[1,5-dihydroxy-2,7,7-trimethyl-3-(trifluoromethyl)cyclohept-2-en-1-yl]-3-methylpenta-2,4-dienal |
| SMILES | CC1=C(C(F)(F)F)CC(O)CC(C)(C)C1(O)/C=C/C(C)=C\C=O |
| InChI | InChI=1S/C17H23F3O3/c1-11(6-8-21)5-7-16(23)12(2)14(17(18,19)20)9-13(22)10-15(16,3)4/h5-8,13,22-23H,9-10H2,1-4H3/b7-5+,11-6- |
| InChIKey | XNRKDEANLCXBBN-WXLRGLDMSA-N |
| XLogP | 3.48 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|