C16H19F3O3 — CID 118646334
(2Z,4E)-5-[1-hydroxy-2,6,6-trimethyl-4-oxo-3-(trifluoromethyl)cyclohex-2-en-1-yl]-3-methylpenta-2,4-dienal (PubChem CID 118646334) has the molecular formula C16H19F3O3 and a molecular weight of 316.32 g/mol. Its IUPAC name is (2Z,4E)-5-[1-hydroxy-2,6,6-trimethyl-4-oxo-3-(trifluoromethyl)cyclohex-2-en-1-yl]-3-methylpenta-2,4-dienal.
| Compound Name | (2Z,4E)-5-[1-hydroxy-2,6,6-trimethyl-4-oxo-3-(trifluoromethyl)cyclohex-2-en-1-yl]-3-methylpenta-2,4-dienal |
|---|---|
| PubChem CID | 118646334 |
| Molecular Formula | C16H19F3O3 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (2Z,4E)-5-[1-hydroxy-2,6,6-trimethyl-4-oxo-3-(trifluoromethyl)cyclohex-2-en-1-yl]-3-methylpenta-2,4-dienal |
| SMILES | CC1=C(C(F)(F)F)C(=O)CC(C)(C)C1(O)/C=C/C(C)=C\C=O |
| InChI | InChI=1S/C16H19F3O3/c1-10(6-8-20)5-7-15(22)11(2)13(16(17,18)19)12(21)9-14(15,3)4/h5-8,22H,9H2,1-4H3/b7-5+,10-6- |
| InChIKey | VJIHDVIWDHUIHK-ZUVZAJTGSA-N |
| XLogP | 3.30 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|