C17H21NO4 — CID 118646573
(2Z,4E)-5-[(1R)-3-(cyanomethyl)-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid (PubChem CID 118646573) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is (2Z,4E)-5-[(1R)-3-(cyanomethyl)-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-5-[(1R)-3-(cyanomethyl)-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 118646573 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (2Z,4E)-5-[(1R)-3-(cyanomethyl)-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CC1=C(CC#N)C(=O)CC(C)(C)[C@]1(O)/C=C/C(C)=C\C(=O)O |
| InChI | InChI=1S/C17H21NO4/c1-11(9-15(20)21)5-7-17(22)12(2)13(6-8-18)14(19)10-16(17,3)4/h5,7,9,22H,6,10H2,1-4H3,(H,20,21)/b7-5+,11-9-/t17-/m0/s1 |
| InChIKey | PMFJSHDNVDVBKL-ZIRLQETASA-N |
| XLogP | 2.53 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|