C21H32O4S — CID 171369879
(PubChem CID 171369879) has the molecular formula C21H32O4S and a molecular weight of 380.55 g/mol.
| Compound Name | |
|---|---|
| PubChem CID | 171369879 |
| Molecular Formula | C21H32O4S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | — |
| SMILES | CCCCCCSC1=C(C)C(O)(C=CC(C)=CC(=O)O)C(C)(C)CC1=O |
| InChI | InChI=1S/C21H32O4S/c1-6-7-8-9-12-26-19-16(3)21(25,20(4,5)14-17(19)22)11-10-15(2)13-18(23)24/h10-11,13,25H,6-9,12,14H2,1-5H3,(H,23,24) |
| InChIKey | AOFXVHRNNSAVEA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|