C19H28O4 — CID 118646424
(2Z,4E)-5-(3-butyl-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid (PubChem CID 118646424) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (2Z,4E)-5-(3-butyl-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-5-(3-butyl-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 118646424 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (2Z,4E)-5-(3-butyl-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid |
| SMILES | CCCCC1=C(C)C(O)(/C=C/C(C)=C\C(=O)O)C(C)(C)CC1=O |
| InChI | InChI=1S/C19H28O4/c1-6-7-8-15-14(3)19(23,18(4,5)12-16(15)20)10-9-13(2)11-17(21)22/h9-11,23H,6-8,12H2,1-5H3,(H,21,22)/b10-9+,13-11- |
| InChIKey | LKCKWYWDUSOEBV-LTCRFSFDSA-N |
| XLogP | 3.81 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|