C23H28O4 — CID 118646200
(2Z,4E)-5-[(1S)-1-hydroxy-2,6,6-trimethyl-3-[(2-methylphenyl)methyl]-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid (PubChem CID 118646200) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is (2Z,4E)-5-[(1S)-1-hydroxy-2,6,6-trimethyl-3-[(2-methylphenyl)methyl]-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-5-[(1S)-1-hydroxy-2,6,6-trimethyl-3-[(2-methylphenyl)methyl]-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 118646200 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (2Z,4E)-5-[(1S)-1-hydroxy-2,6,6-trimethyl-3-[(2-methylphenyl)methyl]-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CC1=C(Cc2ccccc2C)C(=O)CC(C)(C)[C@@]1(O)/C=C/C(C)=C\C(=O)O |
| InChI | InChI=1S/C23H28O4/c1-15(12-21(25)26)10-11-23(27)17(3)19(20(24)14-22(23,4)5)13-18-9-7-6-8-16(18)2/h6-12,27H,13-14H2,1-5H3,(H,25,26)/b11-10+,15-12-/t23-/m1/s1 |
| InChIKey | PSEWNRTZHIFHII-LRANYJEYSA-N |
| XLogP | 4.17 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|