C23H27FO4 — CID 118646211
methyl (2Z,4E)-5-[(1S)-3-[(2-fluorophenyl)methyl]-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoate (PubChem CID 118646211) has the molecular formula C23H27FO4 and a molecular weight of 386.46 g/mol. Its IUPAC name is methyl (2Z,4E)-5-[(1S)-3-[(2-fluorophenyl)methyl]-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoate.
| Compound Name | methyl (2Z,4E)-5-[(1S)-3-[(2-fluorophenyl)methyl]-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 118646211 |
| Molecular Formula | C23H27FO4 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | methyl (2Z,4E)-5-[(1S)-3-[(2-fluorophenyl)methyl]-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoate |
| SMILES | COC(=O)/C=C(C)\C=C\[C@@]1(O)C(C)=C(Cc2ccccc2F)C(=O)CC1(C)C |
| InChI | InChI=1S/C23H27FO4/c1-15(12-21(26)28-5)10-11-23(27)16(2)18(20(25)14-22(23,3)4)13-17-8-6-7-9-19(17)24/h6-12,27H,13-14H2,1-5H3/b11-10+,15-12-/t23-/m1/s1 |
| InChIKey | LGPLTQAOPDTAOD-LRANYJEYSA-N |
| XLogP | 4.09 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|