C19H24N2O2S2 — CID 144997375
(2Z,4E)-7-methyl-N-[(2E)-2-(thiophen-2-ylmethylideneamino)penta-2,4-dienyl]octa-2,4,6-triene-4-sulfonamide (PubChem CID 144997375) has the molecular formula C19H24N2O2S2 and a molecular weight of 376.55 g/mol. Its IUPAC name is (2Z,4E)-7-methyl-N-[(2E)-2-(thiophen-2-ylmethylideneamino)penta-2,4-dienyl]octa-2,4,6-triene-4-sulfonamide.
| Compound Name | (2Z,4E)-7-methyl-N-[(2E)-2-(thiophen-2-ylmethylideneamino)penta-2,4-dienyl]octa-2,4,6-triene-4-sulfonamide |
|---|---|
| PubChem CID | 144997375 |
| Molecular Formula | C19H24N2O2S2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (2Z,4E)-7-methyl-N-[(2E)-2-(thiophen-2-ylmethylideneamino)penta-2,4-dienyl]octa-2,4,6-triene-4-sulfonamide |
| SMILES | C=C/C=C(CNS(=O)(=O)C(/C=C\C)=C/C=C(C)C)/N=C/c1cccs1 |
| InChI | InChI=1S/C19H24N2O2S2/c1-5-8-17(20-15-18-10-7-13-24-18)14-21-25(22,23)19(9-6-2)12-11-16(3)4/h5-13,15,21H,1,14H2,2-4H3/b9-6-,17-8+,19-12+,20-15+ |
| InChIKey | XUUOJCMTARDLMQ-JDFNHBEVSA-N |
| XLogP | 4.58 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|