C14H16N2O4S3 — CID 2819711
methyl 4-propylsulfonyl-3-[2-(thiophen-2-ylmethylidene)hydrazinyl]thiophene-2-carboxylate (PubChem CID 2819711) has the molecular formula C14H16N2O4S3 and a molecular weight of 372.49 g/mol. Its IUPAC name is methyl 4-propylsulfonyl-3-[2-(thiophen-2-ylmethylidene)hydrazinyl]thiophene-2-carboxylate.
| Compound Name | methyl 4-propylsulfonyl-3-[2-(thiophen-2-ylmethylidene)hydrazinyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 2819711 |
| Molecular Formula | C14H16N2O4S3 |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | methyl 4-propylsulfonyl-3-[2-(thiophen-2-ylmethylidene)hydrazinyl]thiophene-2-carboxylate |
| SMILES | CCCS(=O)(=O)c1csc(C(=O)OC)c1NN=Cc1cccs1 |
| InChI | InChI=1S/C14H16N2O4S3/c1-3-7-23(18,19)11-9-22-13(14(17)20-2)12(11)16-15-8-10-5-4-6-21-10/h4-6,8-9,16H,3,7H2,1-2H3 |
| InChIKey | MWIRZRNCOIXION-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|