C13H8N4O4S3 — CID 6376145
methyl 4-cyano-3-[(2E)-2-[cyano(thiophen-2-ylsulfonyl)methylidene]hydrazinyl]thiophene-2-carboxylate (PubChem CID 6376145) has the molecular formula C13H8N4O4S3 and a molecular weight of 380.43 g/mol. Its IUPAC name is methyl 4-cyano-3-[(2E)-2-[cyano(thiophen-2-ylsulfonyl)methylidene]hydrazinyl]thiophene-2-carboxylate.
| Compound Name | methyl 4-cyano-3-[(2E)-2-[cyano(thiophen-2-ylsulfonyl)methylidene]hydrazinyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 6376145 |
| Molecular Formula | C13H8N4O4S3 |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 379.97 |
| IUPAC Name | methyl 4-cyano-3-[(2E)-2-[cyano(thiophen-2-ylsulfonyl)methylidene]hydrazinyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C#N)c1N/N=C(\C#N)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C13H8N4O4S3/c1-21-13(18)12-11(8(5-14)7-23-12)17-16-9(6-15)24(19,20)10-3-2-4-22-10/h2-4,7,17H,1H3/b16-9+ |
| InChIKey | XRTSQEYCWCLLDE-CXUHLZMHSA-N |
| XLogP | 2.19 |
| TPSA | 132.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyano_imine_C(12)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|