C14H12N2O3S2 — CID 64690575
N-(4-cyanophenyl)-2-thiophen-2-ylsulfonylpropanamide (PubChem CID 64690575) has the molecular formula C14H12N2O3S2 and a molecular weight of 320.40 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-thiophen-2-ylsulfonylpropanamide.
| Compound Name | N-(4-cyanophenyl)-2-thiophen-2-ylsulfonylpropanamide |
|---|---|
| PubChem CID | 64690575 |
| Molecular Formula | C14H12N2O3S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | N-(4-cyanophenyl)-2-thiophen-2-ylsulfonylpropanamide |
| SMILES | CC(C(=O)Nc1ccc(C#N)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H12N2O3S2/c1-10(21(18,19)13-3-2-8-20-13)14(17)16-12-6-4-11(9-15)5-7-12/h2-8,10H,1H3,(H,16,17) |
| InChIKey | JPQZFJUUFZJRMR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |