C16H17ClN2O4S2 — CID 2819643
methyl 3-[2-[(2-chlorophenyl)methylidene]hydrazinyl]-4-propan-2-ylsulfonylthiophene-2-carboxylate (PubChem CID 2819643) has the molecular formula C16H17ClN2O4S2 and a molecular weight of 400.91 g/mol. Its IUPAC name is methyl 3-[2-[(2-chlorophenyl)methylidene]hydrazinyl]-4-propan-2-ylsulfonylthiophene-2-carboxylate.
| Compound Name | methyl 3-[2-[(2-chlorophenyl)methylidene]hydrazinyl]-4-propan-2-ylsulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 2819643 |
| Molecular Formula | C16H17ClN2O4S2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | methyl 3-[2-[(2-chlorophenyl)methylidene]hydrazinyl]-4-propan-2-ylsulfonylthiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(S(=O)(=O)C(C)C)c1NN=Cc1ccccc1Cl |
| InChI | InChI=1S/C16H17ClN2O4S2/c1-10(2)25(21,22)13-9-24-15(16(20)23-3)14(13)19-18-8-11-6-4-5-7-12(11)17/h4-10,19H,1-3H3 |
| InChIKey | GVVNJTDXMGLEGT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|