C12H11ClN4O2S — CID 6292692
ethyl 5-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]thiadiazole-4-carboxylate (PubChem CID 6292692) has the molecular formula C12H11ClN4O2S and a molecular weight of 310.77 g/mol. Its IUPAC name is ethyl 5-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]thiadiazole-4-carboxylate.
| Compound Name | ethyl 5-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]thiadiazole-4-carboxylate |
|---|---|
| PubChem CID | 6292692 |
| Molecular Formula | C12H11ClN4O2S |
| Molecular Weight | 310.77 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | ethyl 5-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]thiadiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnsc1N/N=C\c1ccccc1Cl |
| InChI | InChI=1S/C12H11ClN4O2S/c1-2-19-12(18)10-11(20-17-15-10)16-14-7-8-5-3-4-6-9(8)13/h3-7,16H,2H2,1H3/b14-7- |
| InChIKey | KVGCXDACAVABFD-AUWJEWJLSA-N |
| XLogP | 2.81 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.77 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|