C14H16N4O5S2 — CID 55671088
ethyl 5-[[2-[benzenesulfonyl(methyl)amino]acetyl]amino]thiadiazole-4-carboxylate (PubChem CID 55671088) has the molecular formula C14H16N4O5S2 and a molecular weight of 384.44 g/mol. Its IUPAC name is ethyl 5-[[2-[benzenesulfonyl(methyl)amino]acetyl]amino]thiadiazole-4-carboxylate.
| Compound Name | ethyl 5-[[2-[benzenesulfonyl(methyl)amino]acetyl]amino]thiadiazole-4-carboxylate |
|---|---|
| PubChem CID | 55671088 |
| Molecular Formula | C14H16N4O5S2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | ethyl 5-[[2-[benzenesulfonyl(methyl)amino]acetyl]amino]thiadiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnsc1NC(=O)CN(C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H16N4O5S2/c1-3-23-14(20)12-13(24-17-16-12)15-11(19)9-18(2)25(21,22)10-7-5-4-6-8-10/h4-8H,3,9H2,1-2H3,(H,15,19) |
| InChIKey | JPNUXJVHOJKQAA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |