C12H14N4O5S3 — CID 55643015
ethyl 5-[[2-[methyl(thiophen-2-ylsulfonyl)amino]acetyl]amino]thiadiazole-4-carboxylate (PubChem CID 55643015) has the molecular formula C12H14N4O5S3 and a molecular weight of 390.47 g/mol. Its IUPAC name is ethyl 5-[[2-[methyl(thiophen-2-ylsulfonyl)amino]acetyl]amino]thiadiazole-4-carboxylate.
| Compound Name | ethyl 5-[[2-[methyl(thiophen-2-ylsulfonyl)amino]acetyl]amino]thiadiazole-4-carboxylate |
|---|---|
| PubChem CID | 55643015 |
| Molecular Formula | C12H14N4O5S3 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | ethyl 5-[[2-[methyl(thiophen-2-ylsulfonyl)amino]acetyl]amino]thiadiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnsc1NC(=O)CN(C)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C12H14N4O5S3/c1-3-21-12(18)10-11(23-15-14-10)13-8(17)7-16(2)24(19,20)9-5-4-6-22-9/h4-6H,3,7H2,1-2H3,(H,13,17) |
| InChIKey | XHGWBZNTFGMTRG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |