C11H16N2 — CID 145002084
2-ethyl-N',4-dimethylbenzenecarboximidamide (PubChem CID 145002084) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-ethyl-N',4-dimethylbenzenecarboximidamide.
| Compound Name | 2-ethyl-N',4-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 145002084 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2-ethyl-N',4-dimethylbenzenecarboximidamide |
| SMILES | CCc1cc(C)ccc1/C(N)=N/C |
| InChI | InChI=1S/C11H16N2/c1-4-9-7-8(2)5-6-10(9)11(12)13-3/h5-7H,4H2,1-3H3,(H2,12,13) |
| InChIKey | IWHVAGBKKFYHOB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|