About 2-ethyl-N',4-dimethylbenzenecarboximidamide
2-ethyl-N',4-dimethylbenzenecarboximidamide (PubChem CID 145002084) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-ethyl-N',4-dimethylbenzenecarboximidamide.
Molecular Properties
| Compound Name | 2-ethyl-N',4-dimethylbenzenecarboximidamide |
| PubChem CID | 145002084 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2-ethyl-N',4-dimethylbenzenecarboximidamide |
| SMILES | CCc1cc(C)ccc1/C(N)=N/C |
| InChI | InChI=1S/C11H16N2/c1-4-9-7-8(2)5-6-10(9)11(12)13-3/h5-7H,4H2,1-3H3,(H2,12,13) |
| InChIKey | IWHVAGBKKFYHOB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-N',4-dimethylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N',4-dimethylbenzenecarboximidamide?
The IUPAC name of 2-ethyl-N',4-dimethylbenzenecarboximidamide (CID 145002084) is 2-ethyl-N',4-dimethylbenzenecarboximidamide.
What is the SMILES notation for 2-ethyl-N',4-dimethylbenzenecarboximidamide?
The canonical SMILES for 2-ethyl-N',4-dimethylbenzenecarboximidamide is CCc1cc(C)ccc1/C(N)=N/C.
What is the InChIKey of 2-ethyl-N',4-dimethylbenzenecarboximidamide?
The InChIKey is IWHVAGBKKFYHOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-4-9-7-8(2)5-6-10(9)11(12)13-3/h5-7H,4H2,1-3H3,(H2,12,13).
What are the key properties of 2-ethyl-N',4-dimethylbenzenecarboximidamide?
2-ethyl-N',4-dimethylbenzenecarboximidamide has a molecular weight of 176.26 g/mol, XLogP of 1.89, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N',4-dimethylbenzenecarboximidamide is sourced from PubChem (CID 145002084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).