C25H30N4O3S — CID 145002510
[6-[5-(6-butyl-2-pyridinyl)-2-methanimidoyl-3-(2-methylsulfinylethoxy)anilino]-2-pyridinyl]methanol (PubChem CID 145002510) has the molecular formula C25H30N4O3S and a molecular weight of 466.61 g/mol. Its IUPAC name is [6-[5-(6-butyl-2-pyridinyl)-2-methanimidoyl-3-(2-methylsulfinylethoxy)anilino]-2-pyridinyl]methanol.
| Compound Name | [6-[5-(6-butyl-2-pyridinyl)-2-methanimidoyl-3-(2-methylsulfinylethoxy)anilino]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 145002510 |
| Molecular Formula | C25H30N4O3S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | [6-[5-(6-butyl-2-pyridinyl)-2-methanimidoyl-3-(2-methylsulfinylethoxy)anilino]-2-pyridinyl]methanol |
| SMILES | [H]/N=C/c1c(Nc2cccc(CO)n2)cc(-c2cccc(CCCC)n2)cc1OCCS(C)=O |
| InChI | InChI=1S/C25H30N4O3S/c1-3-4-7-19-8-5-10-22(27-19)18-14-23(29-25-11-6-9-20(17-30)28-25)21(16-26)24(15-18)32-12-13-33(2)31/h5-6,8-11,14-16,26,30H,3-4,7,12-13,17H2,1-2H3,(H,28,29)/b26-16+ |
| InChIKey | MQBBBLSEIOFFSN-WGOQTCKBSA-N |
| XLogP | 4.48 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|