C24H27N5O2 — CID 155123690
[6-[6-[6-(4-aminobutyl)-2-pyridinyl]-4-ethoxyindazol-1-yl]-2-pyridinyl]methanol (PubChem CID 155123690) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is [6-[6-[6-(4-aminobutyl)-2-pyridinyl]-4-ethoxyindazol-1-yl]-2-pyridinyl]methanol.
| Compound Name | [6-[6-[6-(4-aminobutyl)-2-pyridinyl]-4-ethoxyindazol-1-yl]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 155123690 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | [6-[6-[6-(4-aminobutyl)-2-pyridinyl]-4-ethoxyindazol-1-yl]-2-pyridinyl]methanol |
| SMILES | CCOc1cc(-c2cccc(CCCCN)n2)cc2c1cnn2-c1cccc(CO)n1 |
| InChI | InChI=1S/C24H27N5O2/c1-2-31-23-14-17(21-10-5-8-18(27-21)7-3-4-12-25)13-22-20(23)15-26-29(22)24-11-6-9-19(16-30)28-24/h5-6,8-11,13-15,30H,2-4,7,12,16,25H2,1H3 |
| InChIKey | DXYLTHNKMKZVCO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|