C21H22N6O — CID 155123770
[6-[6-[6-(4-aminobutyl)-2-pyridinyl]indazol-1-yl]pyrazin-2-yl]methanol (PubChem CID 155123770) has the molecular formula C21H22N6O and a molecular weight of 374.45 g/mol. Its IUPAC name is [6-[6-[6-(4-aminobutyl)-2-pyridinyl]indazol-1-yl]pyrazin-2-yl]methanol.
| Compound Name | [6-[6-[6-(4-aminobutyl)-2-pyridinyl]indazol-1-yl]pyrazin-2-yl]methanol |
|---|---|
| PubChem CID | 155123770 |
| Molecular Formula | C21H22N6O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | [6-[6-[6-(4-aminobutyl)-2-pyridinyl]indazol-1-yl]pyrazin-2-yl]methanol |
| SMILES | NCCCCc1cccc(-c2ccc3cnn(-c4cncc(CO)n4)c3c2)n1 |
| InChI | InChI=1S/C21H22N6O/c22-9-2-1-4-17-5-3-6-19(25-17)15-7-8-16-11-24-27(20(16)10-15)21-13-23-12-18(14-28)26-21/h3,5-8,10-13,28H,1-2,4,9,14,22H2 |
| InChIKey | ITGPZXDVCWHATF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|