C22H24N6O2 — CID 118663987
[6-[6-[6-[(1S)-1-aminopropyl]-2-pyridinyl]-4-ethoxyindazol-1-yl]pyrazin-2-yl]methanol (PubChem CID 118663987) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is [6-[6-[6-[(1S)-1-aminopropyl]-2-pyridinyl]-4-ethoxyindazol-1-yl]pyrazin-2-yl]methanol.
| Compound Name | [6-[6-[6-[(1S)-1-aminopropyl]-2-pyridinyl]-4-ethoxyindazol-1-yl]pyrazin-2-yl]methanol |
|---|---|
| PubChem CID | 118663987 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | [6-[6-[6-[(1S)-1-aminopropyl]-2-pyridinyl]-4-ethoxyindazol-1-yl]pyrazin-2-yl]methanol |
| SMILES | CCOc1cc(-c2cccc([C@@H](N)CC)n2)cc2c1cnn2-c1cncc(CO)n1 |
| InChI | InChI=1S/C22H24N6O2/c1-3-17(23)19-7-5-6-18(27-19)14-8-20-16(21(9-14)30-4-2)11-25-28(20)22-12-24-10-15(13-29)26-22/h5-12,17,29H,3-4,13,23H2,1-2H3/t17-/m0/s1 |
| InChIKey | CGSUYUAVFCLGOP-KRWDZBQOSA-N |
| XLogP | 3.18 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |