C23H26N6O3 — CID 118664211
[6-[6-[6-[(1S)-1-aminopropyl]-2-pyridinyl]-4-(2-methoxyethoxy)indazol-1-yl]pyrazin-2-yl]methanol (PubChem CID 118664211) has the molecular formula C23H26N6O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is [6-[6-[6-[(1S)-1-aminopropyl]-2-pyridinyl]-4-(2-methoxyethoxy)indazol-1-yl]pyrazin-2-yl]methanol.
| Compound Name | [6-[6-[6-[(1S)-1-aminopropyl]-2-pyridinyl]-4-(2-methoxyethoxy)indazol-1-yl]pyrazin-2-yl]methanol |
|---|---|
| PubChem CID | 118664211 |
| Molecular Formula | C23H26N6O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | [6-[6-[6-[(1S)-1-aminopropyl]-2-pyridinyl]-4-(2-methoxyethoxy)indazol-1-yl]pyrazin-2-yl]methanol |
| SMILES | CC[C@H](N)c1cccc(-c2cc(OCCOC)c3cnn(-c4cncc(CO)n4)c3c2)n1 |
| InChI | InChI=1S/C23H26N6O3/c1-3-18(24)20-6-4-5-19(28-20)15-9-21-17(22(10-15)32-8-7-31-2)12-26-29(21)23-13-25-11-16(14-30)27-23/h4-6,9-13,18,30H,3,7-8,14,24H2,1-2H3/t18-/m0/s1 |
| InChIKey | HFHOIHABNJPOMK-SFHVURJKSA-N |
| XLogP | 2.80 |
| TPSA | 121.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|