C25H29N5O4 — CID 118664265
4-amino-4-[6-[1-[6-(hydroxymethyl)-2-pyridinyl]-4-(2-methoxyethoxy)indazol-6-yl]-2-pyridinyl]butan-1-ol (PubChem CID 118664265) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is 4-amino-4-[6-[1-[6-(hydroxymethyl)-2-pyridinyl]-4-(2-methoxyethoxy)indazol-6-yl]-2-pyridinyl]butan-1-ol.
| Compound Name | 4-amino-4-[6-[1-[6-(hydroxymethyl)-2-pyridinyl]-4-(2-methoxyethoxy)indazol-6-yl]-2-pyridinyl]butan-1-ol |
|---|---|
| PubChem CID | 118664265 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 4-amino-4-[6-[1-[6-(hydroxymethyl)-2-pyridinyl]-4-(2-methoxyethoxy)indazol-6-yl]-2-pyridinyl]butan-1-ol |
| SMILES | COCCOc1cc(-c2cccc(C(N)CCCO)n2)cc2c1cnn2-c1cccc(CO)n1 |
| InChI | InChI=1S/C25H29N5O4/c1-33-11-12-34-24-14-17(21-7-3-8-22(29-21)20(26)6-4-10-31)13-23-19(24)15-27-30(23)25-9-2-5-18(16-32)28-25/h2-3,5,7-9,13-15,20,31-32H,4,6,10-12,16,26H2,1H3 |
| InChIKey | AHGWSAPZZQMCBV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|