C25H29N5O3 — CID 166646236
[6-[6-[6-(1-amino-2-methoxybutyl)-2-pyridinyl]-4-ethoxyindazol-1-yl]-2-pyridinyl]methanol (PubChem CID 166646236) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is [6-[6-[6-(1-amino-2-methoxybutyl)-2-pyridinyl]-4-ethoxyindazol-1-yl]-2-pyridinyl]methanol.
| Compound Name | [6-[6-[6-(1-amino-2-methoxybutyl)-2-pyridinyl]-4-ethoxyindazol-1-yl]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 166646236 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | [6-[6-[6-(1-amino-2-methoxybutyl)-2-pyridinyl]-4-ethoxyindazol-1-yl]-2-pyridinyl]methanol |
| SMILES | CCOc1cc(-c2cccc(C(N)C(CC)OC)n2)cc2c1cnn2-c1cccc(CO)n1 |
| InChI | InChI=1S/C25H29N5O3/c1-4-22(32-3)25(26)20-10-7-9-19(29-20)16-12-21-18(23(13-16)33-5-2)14-27-30(21)24-11-6-8-17(15-31)28-24/h6-14,22,25,31H,4-5,15,26H2,1-3H3 |
| InChIKey | OJOYYPSJKDRXHN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |