C21H19F3N6 — CID 155123696
4-[6-[1-[6-(trifluoromethyl)pyrazin-2-yl]indazol-6-yl]-2-pyridinyl]butan-1-amine (PubChem CID 155123696) has the molecular formula C21H19F3N6 and a molecular weight of 412.42 g/mol. Its IUPAC name is 4-[6-[1-[6-(trifluoromethyl)pyrazin-2-yl]indazol-6-yl]-2-pyridinyl]butan-1-amine.
| Compound Name | 4-[6-[1-[6-(trifluoromethyl)pyrazin-2-yl]indazol-6-yl]-2-pyridinyl]butan-1-amine |
|---|---|
| PubChem CID | 155123696 |
| Molecular Formula | C21H19F3N6 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 4-[6-[1-[6-(trifluoromethyl)pyrazin-2-yl]indazol-6-yl]-2-pyridinyl]butan-1-amine |
| SMILES | NCCCCc1cccc(-c2ccc3cnn(-c4cncc(C(F)(F)F)n4)c3c2)n1 |
| InChI | InChI=1S/C21H19F3N6/c22-21(23,24)19-12-26-13-20(29-19)30-18-10-14(7-8-15(18)11-27-30)17-6-3-5-16(28-17)4-1-2-9-25/h3,5-8,10-13H,1-2,4,9,25H2 |
| InChIKey | VCFAOGURZOVPCH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|