C31H40Br2N2O4 — CID 145004382
[5-[7-(bromomethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxy-2,5-dimethylhexan-2-yl] 7-(bromomethyl)-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate (PubChem CID 145004382) has the molecular formula C31H40Br2N2O4 and a molecular weight of 664.48 g/mol. Its IUPAC name is [5-[7-(bromomethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxy-2,5-dimethylhexan-2-yl] 7-(bromomethyl)-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate.
| Compound Name | [5-[7-(bromomethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxy-2,5-dimethylhexan-2-yl] 7-(bromomethyl)-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
|---|---|
| PubChem CID | 145004382 |
| Molecular Formula | C31H40Br2N2O4 |
| Molecular Weight | 664.48 g/mol |
| Exact Mass | 662.14 |
| IUPAC Name | [5-[7-(bromomethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxy-2,5-dimethylhexan-2-yl] 7-(bromomethyl)-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
| SMILES | CC(C)(CCC(C)(C)OC(=O)N1CCc2ccc(CBr)cc2C1)OC(=O)N1CCc2ccc(CBr)cc2CC1 |
| InChI | InChI=1S/C31H40Br2N2O4/c1-30(2,38-28(36)34-14-9-24-7-5-22(19-32)17-26(24)11-15-34)12-13-31(3,4)39-29(37)35-16-10-25-8-6-23(20-33)18-27(25)21-35/h5-8,17-18H,9-16,19-21H2,1-4H3 |
| InChIKey | WYGOOOIWOMFVIC-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.48 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|