C20H26FNO2 — CID 145005102
2-fluoro-4-methylbenzonitrile;prop-1-ene;2,2,4,5-tetramethyl-3H-pyran-6-one (PubChem CID 145005102) has the molecular formula C20H26FNO2 and a molecular weight of 331.43 g/mol. Its IUPAC name is 2-fluoro-4-methylbenzonitrile;prop-1-ene;2,2,4,5-tetramethyl-3H-pyran-6-one.
| Compound Name | 2-fluoro-4-methylbenzonitrile;prop-1-ene;2,2,4,5-tetramethyl-3H-pyran-6-one |
|---|---|
| PubChem CID | 145005102 |
| Molecular Formula | C20H26FNO2 |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 2-fluoro-4-methylbenzonitrile;prop-1-ene;2,2,4,5-tetramethyl-3H-pyran-6-one |
| SMILES | C=CC.CC1=C(C)C(=O)OC(C)(C)C1.Cc1ccc(C#N)c(F)c1 |
| InChI | InChI=1S/C9H14O2.C8H6FN.C3H6/c1-6-5-9(3,4)11-8(10)7(6)2;1-6-2-3-7(5-10)8(9)4-6;1-3-2/h5H2,1-4H3;2-4H,1H3;3H,1H2,2H3 |
| InChIKey | JUNIOXFXRVLVMD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|