C25H29N5O — CID 145005470
1-[4-[[2-methanimidoyl-4-(1H-pyrazol-4-yl)anilino]methyl]piperidin-1-yl]-3-phenylpropan-1-one (PubChem CID 145005470) has the molecular formula C25H29N5O and a molecular weight of 415.54 g/mol. Its IUPAC name is 1-[4-[[2-methanimidoyl-4-(1H-pyrazol-4-yl)anilino]methyl]piperidin-1-yl]-3-phenylpropan-1-one.
| Compound Name | 1-[4-[[2-methanimidoyl-4-(1H-pyrazol-4-yl)anilino]methyl]piperidin-1-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 145005470 |
| Molecular Formula | C25H29N5O |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 1-[4-[[2-methanimidoyl-4-(1H-pyrazol-4-yl)anilino]methyl]piperidin-1-yl]-3-phenylpropan-1-one |
| SMILES | [H]/N=C/c1cc(-c2cn[nH]c2)ccc1NCC1CCN(C(=O)CCc2ccccc2)CC1 |
| InChI | InChI=1S/C25H29N5O/c26-15-22-14-21(23-17-28-29-18-23)7-8-24(22)27-16-20-10-12-30(13-11-20)25(31)9-6-19-4-2-1-3-5-19/h1-5,7-8,14-15,17-18,20,26-27H,6,9-13,16H2,(H,28,29)/b26-15+ |
| InChIKey | MFDCYGXDONXMRE-CVKSISIWSA-N |
| XLogP | 4.36 |
| TPSA | 84.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|