C24H27N5O — CID 145005401
[4-[[2-methanimidoyl-4-(1H-pyrazol-4-yl)anilino]methyl]-2-methylpyrrolidin-1-yl]-(4-methylphenyl)methanone (PubChem CID 145005401) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is [4-[[2-methanimidoyl-4-(1H-pyrazol-4-yl)anilino]methyl]-2-methylpyrrolidin-1-yl]-(4-methylphenyl)methanone.
| Compound Name | [4-[[2-methanimidoyl-4-(1H-pyrazol-4-yl)anilino]methyl]-2-methylpyrrolidin-1-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 145005401 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | [4-[[2-methanimidoyl-4-(1H-pyrazol-4-yl)anilino]methyl]-2-methylpyrrolidin-1-yl]-(4-methylphenyl)methanone |
| SMILES | [H]/N=C/c1cc(-c2cn[nH]c2)ccc1NCC1CC(C)N(C(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C24H27N5O/c1-16-3-5-19(6-4-16)24(30)29-15-18(9-17(29)2)12-26-23-8-7-20(10-21(23)11-25)22-13-27-28-14-22/h3-8,10-11,13-14,17-18,25-26H,9,12,15H2,1-2H3,(H,27,28)/b25-11+ |
| InChIKey | RCCOFEUIJPAVKV-OPEKNORGSA-N |
| XLogP | 4.35 |
| TPSA | 84.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|