C23H25FN5O+ — CID 145005498
[2-[[1-(3-fluorobenzoyl)-5-methylpyrrolidin-3-yl]methylamino]-5-(1H-pyrazol-4-yl)phenyl]methylideneazanium (PubChem CID 145005498) has the molecular formula C23H25FN5O+ and a molecular weight of 406.49 g/mol. Its IUPAC name is [2-[[1-(3-fluorobenzoyl)-5-methylpyrrolidin-3-yl]methylamino]-5-(1H-pyrazol-4-yl)phenyl]methylideneazanium.
| Compound Name | [2-[[1-(3-fluorobenzoyl)-5-methylpyrrolidin-3-yl]methylamino]-5-(1H-pyrazol-4-yl)phenyl]methylideneazanium |
|---|---|
| PubChem CID | 145005498 |
| Molecular Formula | C23H25FN5O+ |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | [2-[[1-(3-fluorobenzoyl)-5-methylpyrrolidin-3-yl]methylamino]-5-(1H-pyrazol-4-yl)phenyl]methylideneazanium |
| SMILES | CC1CC(CNc2ccc(-c3cn[nH]c3)cc2C=[NH2+])CN1C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C23H24FN5O/c1-15-7-16(14-29(15)23(30)18-3-2-4-21(24)9-18)11-26-22-6-5-17(8-19(22)10-25)20-12-27-28-13-20/h2-6,8-10,12-13,15-16,25-26H,7,11,14H2,1H3,(H,27,28)/p+1 |
| InChIKey | JYCYQGXSTNCTKV-UHFFFAOYSA-O |
| XLogP | 2.36 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|