C23H25N6S+ — CID 145005467
[2-[[(5S)-1-(3-cyanophenyl)sulfanyl-5-methylpyrrolidin-3-yl]methylamino]-5-(1H-pyrazol-4-yl)phenyl]methylideneazanium (PubChem CID 145005467) has the molecular formula C23H25N6S+ and a molecular weight of 417.56 g/mol. Its IUPAC name is [2-[[(5S)-1-(3-cyanophenyl)sulfanyl-5-methylpyrrolidin-3-yl]methylamino]-5-(1H-pyrazol-4-yl)phenyl]methylideneazanium.
| Compound Name | [2-[[(5S)-1-(3-cyanophenyl)sulfanyl-5-methylpyrrolidin-3-yl]methylamino]-5-(1H-pyrazol-4-yl)phenyl]methylideneazanium |
|---|---|
| PubChem CID | 145005467 |
| Molecular Formula | C23H25N6S+ |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | [2-[[(5S)-1-(3-cyanophenyl)sulfanyl-5-methylpyrrolidin-3-yl]methylamino]-5-(1H-pyrazol-4-yl)phenyl]methylideneazanium |
| SMILES | C[C@H]1CC(CNc2ccc(-c3cn[nH]c3)cc2C=[NH2+])CN1Sc1cccc(C#N)c1 |
| InChI | InChI=1S/C23H24N6S/c1-16-7-18(15-29(16)30-22-4-2-3-17(8-22)10-24)12-26-23-6-5-19(9-20(23)11-25)21-13-27-28-14-21/h2-6,8-9,11,13-14,16,18,25-26H,7,12,15H2,1H3,(H,27,28)/p+1/t16-,18?/m0/s1 |
| InChIKey | MKIUMYNDIDENKH-ATNAJCNCSA-O |
| XLogP | 2.96 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|