C23H27N5O2S — CID 145005534
2-methanimidoyl-N-[[1-(4-methylphenyl)sulfonylpiperidin-4-yl]methyl]-4-(1H-pyrazol-4-yl)aniline (PubChem CID 145005534) has the molecular formula C23H27N5O2S and a molecular weight of 437.57 g/mol. Its IUPAC name is 2-methanimidoyl-N-[[1-(4-methylphenyl)sulfonylpiperidin-4-yl]methyl]-4-(1H-pyrazol-4-yl)aniline.
| Compound Name | 2-methanimidoyl-N-[[1-(4-methylphenyl)sulfonylpiperidin-4-yl]methyl]-4-(1H-pyrazol-4-yl)aniline |
|---|---|
| PubChem CID | 145005534 |
| Molecular Formula | C23H27N5O2S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 2-methanimidoyl-N-[[1-(4-methylphenyl)sulfonylpiperidin-4-yl]methyl]-4-(1H-pyrazol-4-yl)aniline |
| SMILES | [H]/N=C/c1cc(-c2cn[nH]c2)ccc1NCC1CCN(S(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C23H27N5O2S/c1-17-2-5-22(6-3-17)31(29,30)28-10-8-18(9-11-28)14-25-23-7-4-19(12-20(23)13-24)21-15-26-27-16-21/h2-7,12-13,15-16,18,24-25H,8-11,14H2,1H3,(H,26,27)/b24-13+ |
| InChIKey | YYCZTBDGSUVTKB-ZMOGYAJESA-N |
| XLogP | 3.90 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|