C24H28FN5O — CID 145005392
ethane;(2-fluorophenyl)-[3-[[2-methanimidoyl-4-(1H-pyrazol-4-yl)anilino]methyl]pyrrolidin-1-yl]methanone (PubChem CID 145005392) has the molecular formula C24H28FN5O and a molecular weight of 421.52 g/mol. Its IUPAC name is ethane;(2-fluorophenyl)-[3-[[2-methanimidoyl-4-(1H-pyrazol-4-yl)anilino]methyl]pyrrolidin-1-yl]methanone.
| Compound Name | ethane;(2-fluorophenyl)-[3-[[2-methanimidoyl-4-(1H-pyrazol-4-yl)anilino]methyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 145005392 |
| Molecular Formula | C24H28FN5O |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | ethane;(2-fluorophenyl)-[3-[[2-methanimidoyl-4-(1H-pyrazol-4-yl)anilino]methyl]pyrrolidin-1-yl]methanone |
| SMILES | CC.[H]/N=C/c1cc(-c2cn[nH]c2)ccc1NCC1CCN(C(=O)c2ccccc2F)C1 |
| InChI | InChI=1S/C22H22FN5O.C2H6/c23-20-4-2-1-3-19(20)22(29)28-8-7-15(14-28)11-25-21-6-5-16(9-17(21)10-24)18-12-26-27-13-18;1-2/h1-6,9-10,12-13,15,24-25H,7-8,11,14H2,(H,26,27);1-2H3/b24-10+; |
| InChIKey | OHFZKJXFLFYLOI-CTVFHSNGSA-N |
| XLogP | 4.81 |
| TPSA | 84.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|