C27H32FN3O — CID 145005407
3-(3-fluorophenyl)-1-[4-[[2-methanimidoyl-4-[(3E)-penta-1,3-dien-3-yl]anilino]methyl]-2-methylpyrrolidin-1-yl]propan-1-one (PubChem CID 145005407) has the molecular formula C27H32FN3O and a molecular weight of 433.57 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-1-[4-[[2-methanimidoyl-4-[(3E)-penta-1,3-dien-3-yl]anilino]methyl]-2-methylpyrrolidin-1-yl]propan-1-one.
| Compound Name | 3-(3-fluorophenyl)-1-[4-[[2-methanimidoyl-4-[(3E)-penta-1,3-dien-3-yl]anilino]methyl]-2-methylpyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 145005407 |
| Molecular Formula | C27H32FN3O |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 3-(3-fluorophenyl)-1-[4-[[2-methanimidoyl-4-[(3E)-penta-1,3-dien-3-yl]anilino]methyl]-2-methylpyrrolidin-1-yl]propan-1-one |
| SMILES | [H]/N=C/c1cc(/C(C=C)=C/C)ccc1NCC1CC(C)N(C(=O)CCc2cccc(F)c2)C1 |
| InChI | InChI=1S/C27H32FN3O/c1-4-22(5-2)23-10-11-26(24(15-23)16-29)30-17-21-13-19(3)31(18-21)27(32)12-9-20-7-6-8-25(28)14-20/h4-8,10-11,14-16,19,21,29-30H,1,9,12-13,17-18H2,2-3H3/b22-5+,29-16+ |
| InChIKey | AQUOTSJWFYCOGT-LCJNFSEWSA-N |
| XLogP | 5.69 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|