C17H15ClN2O2 — CID 145006160
3-chloro-N-[4-[(1R,5S)-6-oxa-3-azabicyclo[3.1.0]hexan-1-yl]phenyl]benzamide (PubChem CID 145006160) has the molecular formula C17H15ClN2O2 and a molecular weight of 314.77 g/mol. Its IUPAC name is 3-chloro-N-[4-[(1R,5S)-6-oxa-3-azabicyclo[3.1.0]hexan-1-yl]phenyl]benzamide.
| Compound Name | 3-chloro-N-[4-[(1R,5S)-6-oxa-3-azabicyclo[3.1.0]hexan-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 145006160 |
| Molecular Formula | C17H15ClN2O2 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 3-chloro-N-[4-[(1R,5S)-6-oxa-3-azabicyclo[3.1.0]hexan-1-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc([C@@]23CNC[C@@H]2O3)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H15ClN2O2/c18-13-3-1-2-11(8-13)16(21)20-14-6-4-12(5-7-14)17-10-19-9-15(17)22-17/h1-8,15,19H,9-10H2,(H,20,21)/t15-,17-/m0/s1 |
| InChIKey | PVPJTENMRLJCLW-RDJZCZTQSA-N |
| XLogP | 2.79 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|