C14H17N5 — CID 145011169
ethane;3-methyl-1-phenylpyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 145011169) has the molecular formula C14H17N5 and a molecular weight of 255.33 g/mol. Its IUPAC name is ethane;3-methyl-1-phenylpyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | ethane;3-methyl-1-phenylpyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 145011169 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | ethane;3-methyl-1-phenylpyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CC.Cc1nn(-c2ccccc2)c2c(N)ncnc12 |
| InChI | InChI=1S/C12H11N5.C2H6/c1-8-10-11(12(13)15-7-14-10)17(16-8)9-5-3-2-4-6-9;1-2/h2-7H,1H3,(H2,13,14,15);1-2H3 |
| InChIKey | DPBOFLQEGXHEFQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |