C15H20FNO — CID 145012027
(3S)-3-[5-(2-fluoropropan-2-yl)-2-bicyclo[5.1.0]octa-1(8),3,5-trienyl]morpholine (PubChem CID 145012027) has the molecular formula C15H20FNO and a molecular weight of 249.33 g/mol. Its IUPAC name is (3S)-3-[5-(2-fluoropropan-2-yl)-2-bicyclo[5.1.0]octa-1(8),3,5-trienyl]morpholine.
| Compound Name | (3S)-3-[5-(2-fluoropropan-2-yl)-2-bicyclo[5.1.0]octa-1(8),3,5-trienyl]morpholine |
|---|---|
| PubChem CID | 145012027 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (3S)-3-[5-(2-fluoropropan-2-yl)-2-bicyclo[5.1.0]octa-1(8),3,5-trienyl]morpholine |
| SMILES | CC(C)(F)C1=CC2C=C2C([C@H]2COCCN2)C=C1 |
| InChI | InChI=1S/C15H20FNO/c1-15(2,16)11-3-4-12(13-8-10(13)7-11)14-9-18-6-5-17-14/h3-4,7-8,10,12,14,17H,5-6,9H2,1-2H3/t10?,12?,14-/m1/s1 |
| InChIKey | FGZADWVYIMRPNN-MMWSSPAHSA-N |
| XLogP | 2.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|