C14H24FNO — CID 106655074
3-[2-(cyclohepten-1-yl)-2-fluoropropyl]morpholine (PubChem CID 106655074) has the molecular formula C14H24FNO and a molecular weight of 241.35 g/mol. Its IUPAC name is 3-[2-(cyclohepten-1-yl)-2-fluoropropyl]morpholine.
| Compound Name | 3-[2-(cyclohepten-1-yl)-2-fluoropropyl]morpholine |
|---|---|
| PubChem CID | 106655074 |
| Molecular Formula | C14H24FNO |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 3-[2-(cyclohepten-1-yl)-2-fluoropropyl]morpholine |
| SMILES | CC(F)(CC1COCCN1)C1=CCCCCC1 |
| InChI | InChI=1S/C14H24FNO/c1-14(15,10-13-11-17-9-8-16-13)12-6-4-2-3-5-7-12/h6,13,16H,2-5,7-11H2,1H3 |
| InChIKey | ZPUFVONMIDSBGU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|