C13H22FNO — CID 106655073
3-[2-(cyclohexen-1-yl)-2-fluoropropyl]morpholine (PubChem CID 106655073) has the molecular formula C13H22FNO and a molecular weight of 227.32 g/mol. Its IUPAC name is 3-[2-(cyclohexen-1-yl)-2-fluoropropyl]morpholine.
| Compound Name | 3-[2-(cyclohexen-1-yl)-2-fluoropropyl]morpholine |
|---|---|
| PubChem CID | 106655073 |
| Molecular Formula | C13H22FNO |
| Molecular Weight | 227.32 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 3-[2-(cyclohexen-1-yl)-2-fluoropropyl]morpholine |
| SMILES | CC(F)(CC1COCCN1)C1=CCCCC1 |
| InChI | InChI=1S/C13H22FNO/c1-13(14,11-5-3-2-4-6-11)9-12-10-16-8-7-15-12/h5,12,15H,2-4,6-10H2,1H3 |
| InChIKey | VCZRELHWOOQGCM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|