C19H41NO — CID 142984267
ethane;(4E,6S)-N,6,7-trimethyl-1-propoxy-4-propylideneoctan-2-amine (PubChem CID 142984267) has the molecular formula C19H41NO and a molecular weight of 299.54 g/mol. Its IUPAC name is ethane;(4E,6S)-N,6,7-trimethyl-1-propoxy-4-propylideneoctan-2-amine.
| Compound Name | ethane;(4E,6S)-N,6,7-trimethyl-1-propoxy-4-propylideneoctan-2-amine |
|---|---|
| PubChem CID | 142984267 |
| Molecular Formula | C19H41NO |
| Molecular Weight | 299.54 g/mol |
| Exact Mass | 299.32 |
| IUPAC Name | ethane;(4E,6S)-N,6,7-trimethyl-1-propoxy-4-propylideneoctan-2-amine |
| SMILES | CC.CC/C=C(/CC(COCCC)NC)C[C@H](C)C(C)C |
| InChI | InChI=1S/C17H35NO.C2H6/c1-7-9-16(11-15(5)14(3)4)12-17(18-6)13-19-10-8-2;1-2/h9,14-15,17-18H,7-8,10-13H2,1-6H3;1-2H3/b16-9+;/t15-,17?;/m0./s1 |
| InChIKey | JEHVAXRBLKEALS-FSJUEWQPSA-N |
| XLogP | 5.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|