C14H18ClN3O2 — CID 145012194
8-chloro-2-morpholin-4-yl-1H-1,7-naphthyridin-4-one;ethane (PubChem CID 145012194) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is 8-chloro-2-morpholin-4-yl-1H-1,7-naphthyridin-4-one;ethane.
| Compound Name | 8-chloro-2-morpholin-4-yl-1H-1,7-naphthyridin-4-one;ethane |
|---|---|
| PubChem CID | 145012194 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 8-chloro-2-morpholin-4-yl-1H-1,7-naphthyridin-4-one;ethane |
| SMILES | CC.O=c1cc(N2CCOCC2)[nH]c2c(Cl)nccc12 |
| InChI | InChI=1S/C12H12ClN3O2.C2H6/c13-12-11-8(1-2-14-12)9(17)7-10(15-11)16-3-5-18-6-4-16;1-2/h1-2,7H,3-6H2,(H,15,17);1-2H3 |
| InChIKey | KUJMRKUDSWNDHO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|