C24H30N4O2 — CID 145012354
5-[(dimethylamino)methyl]-10-[[4-[(hydroxyamino)methyl]phenyl]methyl]-1,3,4,5-tetrahydroazepino[3,4-b]indole-2-carbaldehyde (PubChem CID 145012354) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 5-[(dimethylamino)methyl]-10-[[4-[(hydroxyamino)methyl]phenyl]methyl]-1,3,4,5-tetrahydroazepino[3,4-b]indole-2-carbaldehyde.
| Compound Name | 5-[(dimethylamino)methyl]-10-[[4-[(hydroxyamino)methyl]phenyl]methyl]-1,3,4,5-tetrahydroazepino[3,4-b]indole-2-carbaldehyde |
|---|---|
| PubChem CID | 145012354 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 5-[(dimethylamino)methyl]-10-[[4-[(hydroxyamino)methyl]phenyl]methyl]-1,3,4,5-tetrahydroazepino[3,4-b]indole-2-carbaldehyde |
| SMILES | CN(C)CC1CCN(C=O)Cc2c1c1ccccc1n2Cc1ccc(CNO)cc1 |
| InChI | InChI=1S/C24H30N4O2/c1-26(2)15-20-11-12-27(17-29)16-23-24(20)21-5-3-4-6-22(21)28(23)14-19-9-7-18(8-10-19)13-25-30/h3-10,17,20,25,30H,11-16H2,1-2H3 |
| InChIKey | BFUONGYBWSNOHR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|