C25H28N4O4 — CID 166835361
N-formyl-9-[[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]cyclohexa-1,5-dien-1-yl]methyl]-N,2-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indole-4-carboxamide (PubChem CID 166835361) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-formyl-9-[[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]cyclohexa-1,5-dien-1-yl]methyl]-N,2-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indole-4-carboxamide.
| Compound Name | N-formyl-9-[[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]cyclohexa-1,5-dien-1-yl]methyl]-N,2-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indole-4-carboxamide |
|---|---|
| PubChem CID | 166835361 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-formyl-9-[[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]cyclohexa-1,5-dien-1-yl]methyl]-N,2-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indole-4-carboxamide |
| SMILES | CN1Cc2c(c3ccccc3n2CC2=CCCC(/C=C/C(=O)NO)=C2)C(C(=O)N(C)C=O)C1 |
| InChI | InChI=1S/C25H28N4O4/c1-27-14-20(25(32)28(2)16-30)24-19-8-3-4-9-21(19)29(22(24)15-27)13-18-7-5-6-17(12-18)10-11-23(31)26-33/h3-4,7-12,16,20,33H,5-6,13-15H2,1-2H3,(H,26,31)/b11-10+ |
| InChIKey | YKLYEHNJKLEIAF-ZHACJKMWSA-N |
| XLogP | 2.49 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|