C20H37N3O6S — CID 145013122
tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-[(E)-C-[(2-methylpropan-2-yl)oxy]-N-(oxan-3-ylsulfanyl)carbonimidoyl]carbamate (PubChem CID 145013122) has the molecular formula C20H37N3O6S and a molecular weight of 447.60 g/mol. Its IUPAC name is tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-[(E)-C-[(2-methylpropan-2-yl)oxy]-N-(oxan-3-ylsulfanyl)carbonimidoyl]carbamate.
| Compound Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-[(E)-C-[(2-methylpropan-2-yl)oxy]-N-(oxan-3-ylsulfanyl)carbonimidoyl]carbamate |
|---|---|
| PubChem CID | 145013122 |
| Molecular Formula | C20H37N3O6S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-[(E)-C-[(2-methylpropan-2-yl)oxy]-N-(oxan-3-ylsulfanyl)carbonimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(C(=O)OC(C)(C)C)/C(=N\SC1CCCOC1)OC(C)(C)C |
| InChI | InChI=1S/C20H37N3O6S/c1-18(2,3)27-15(22-30-14-11-10-12-26-13-14)23(17(25)29-20(7,8)9)21-16(24)28-19(4,5)6/h14H,10-13H2,1-9H3,(H,21,24)/b22-15+ |
| InChIKey | FFHZERLBTBSITI-PXLXIMEGSA-N |
| XLogP | 4.66 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|