C19H36Br2S — CID 145013688
2,6-dibromo-5-dodecyl-3,4-dihydro-2H-thiopyran;ethane (PubChem CID 145013688) has the molecular formula C19H36Br2S and a molecular weight of 456.37 g/mol. Its IUPAC name is 2,6-dibromo-5-dodecyl-3,4-dihydro-2H-thiopyran;ethane.
| Compound Name | 2,6-dibromo-5-dodecyl-3,4-dihydro-2H-thiopyran;ethane |
|---|---|
| PubChem CID | 145013688 |
| Molecular Formula | C19H36Br2S |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 2,6-dibromo-5-dodecyl-3,4-dihydro-2H-thiopyran;ethane |
| SMILES | CC.CCCCCCCCCCCCC1=C(Br)SC(Br)CC1 |
| InChI | InChI=1S/C17H30Br2S.C2H6/c1-2-3-4-5-6-7-8-9-10-11-12-15-13-14-16(18)20-17(15)19;1-2/h16H,2-14H2,1H3;1-2H3 |
| InChIKey | HWQSUPJADIJZJD-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|